C25H34FN5OS — CID 125045594
1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-methoxy-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea (PubChem CID 125045594) has the molecular formula C25H34FN5OS and a molecular weight of 471.65 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-methoxy-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea.
| Compound Name | 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-methoxy-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 125045594 |
| Molecular Formula | C25H34FN5OS |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-methoxy-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
| SMILES | COc1cc(N2CCCC[C@H]2C)nc(NC(=S)NCC2(c3ccc(F)cc3)CCCCC2)n1 |
| InChI | InChI=1S/C25H34FN5OS/c1-18-8-4-7-15-31(18)21-16-22(32-2)29-23(28-21)30-24(33)27-17-25(13-5-3-6-14-25)19-9-11-20(26)12-10-19/h9-12,16,18H,3-8,13-15,17H2,1-2H3,(H2,27,28,29,30,33)/t18-/m1/s1 |
| InChIKey | AZQVALWYADAABH-GOSISDBHSA-N |
| XLogP | 5.19 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|