C19H24FN5OS — CID 125045782
1-[(4-fluorophenyl)methyl]-3-[4-methoxy-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea (PubChem CID 125045782) has the molecular formula C19H24FN5OS and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[4-methoxy-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[4-methoxy-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 125045782 |
| Molecular Formula | C19H24FN5OS |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[4-methoxy-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
| SMILES | COc1cc(N2CCCC[C@H]2C)nc(NC(=S)NCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H24FN5OS/c1-13-5-3-4-10-25(13)16-11-17(26-2)23-18(22-16)24-19(27)21-12-14-6-8-15(20)9-7-14/h6-9,11,13H,3-5,10,12H2,1-2H3,(H2,21,22,23,24,27)/t13-/m1/s1 |
| InChIKey | GBHRRJFYTPEDTH-CYBMUJFWSA-N |
| XLogP | 3.49 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|