C18H21ClFN5S — CID 100783719
1-[4-chloro-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 100783719) has the molecular formula C18H21ClFN5S and a molecular weight of 393.92 g/mol. Its IUPAC name is 1-[4-chloro-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[4-chloro-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100783719 |
| Molecular Formula | C18H21ClFN5S |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-[4-chloro-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | C[C@H]1CCCCN1c1cc(Cl)nc(NC(=S)NCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H21ClFN5S/c1-12-4-2-3-9-25(12)16-10-15(19)22-17(23-16)24-18(26)21-11-13-5-7-14(20)8-6-13/h5-8,10,12H,2-4,9,11H2,1H3,(H2,21,22,23,24,26)/t12-/m0/s1 |
| InChIKey | LFNSHYCYAUACPT-LBPRGKRZSA-N |
| XLogP | 4.13 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|