C14H20ClN5S — CID 100780611
1-[4-chloro-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-prop-2-enylthiourea (PubChem CID 100780611) has the molecular formula C14H20ClN5S and a molecular weight of 325.87 g/mol. Its IUPAC name is 1-[4-chloro-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[4-chloro-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 100780611 |
| Molecular Formula | C14H20ClN5S |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-[4-chloro-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1nc(Cl)cc(N2CCCC[C@@H]2C)n1 |
| InChI | InChI=1S/C14H20ClN5S/c1-3-7-16-14(21)19-13-17-11(15)9-12(18-13)20-8-5-4-6-10(20)2/h3,9-10H,1,4-8H2,2H3,(H2,16,17,18,19,21)/t10-/m0/s1 |
| InChIKey | WXCFGIBNGGOSTO-JTQLQIEISA-N |
| XLogP | 2.98 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|