C16H27N5OS — CID 125047851
1-[4-methoxy-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-(2-methylpropyl)thiourea (PubChem CID 125047851) has the molecular formula C16H27N5OS and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-[4-methoxy-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[4-methoxy-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 125047851 |
| Molecular Formula | C16H27N5OS |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 1-[4-methoxy-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-(2-methylpropyl)thiourea |
| SMILES | COc1cc(N2CCCC[C@H]2C)nc(NC(=S)NCC(C)C)n1 |
| InChI | InChI=1S/C16H27N5OS/c1-11(2)10-17-16(23)20-15-18-13(9-14(19-15)22-4)21-8-6-5-7-12(21)3/h9,11-12H,5-8,10H2,1-4H3,(H2,17,18,19,20,23)/t12-/m1/s1 |
| InChIKey | BQHXENSGDAYUGR-GFCCVEGCSA-N |
| XLogP | 2.81 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|