C24H32FN5O2S — CID 133179038
1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-[4-methoxy-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 133179038) has the molecular formula C24H32FN5O2S and a molecular weight of 473.62 g/mol. Its IUPAC name is 1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-[4-methoxy-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-[4-methoxy-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133179038 |
| Molecular Formula | C24H32FN5O2S |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-[4-methoxy-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | COc1cc(N2CCCCC2C)nc(NC(=S)NCC2(c3ccc(F)cc3)CCOCC2)n1 |
| InChI | InChI=1S/C24H32FN5O2S/c1-17-5-3-4-12-30(17)20-15-21(31-2)28-22(27-20)29-23(33)26-16-24(10-13-32-14-11-24)18-6-8-19(25)9-7-18/h6-9,15,17H,3-5,10-14,16H2,1-2H3,(H2,26,27,28,29,33) |
| InChIKey | KJDCAFZCXIVFKP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|