C29H42N6OS — CID 133178947
1-[4-(azepan-1-yl)-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea (PubChem CID 133178947) has the molecular formula C29H42N6OS and a molecular weight of 522.76 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 133178947 |
| Molecular Formula | C29H42N6OS |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
| SMILES | CC1CCCCN1c1cc(N2CCCCCC2)nc(NC(=S)NCC2(c3ccccc3)CCOCC2)n1 |
| InChI | InChI=1S/C29H42N6OS/c1-23-11-7-10-18-35(23)26-21-25(34-16-8-2-3-9-17-34)31-27(32-26)33-28(37)30-22-29(14-19-36-20-15-29)24-12-5-4-6-13-24/h4-6,12-13,21,23H,2-3,7-11,14-20,22H2,1H3,(H2,30,31,32,33,37) |
| InChIKey | KEBRONXZBMHGFO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|