C30H43ClN6S — CID 100788332
1-[4-(azepan-1-yl)-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[1-(4-chlorophenyl)cyclohexyl]methyl]thiourea (PubChem CID 100788332) has the molecular formula C30H43ClN6S and a molecular weight of 555.24 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[1-(4-chlorophenyl)cyclohexyl]methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[1-(4-chlorophenyl)cyclohexyl]methyl]thiourea |
|---|---|
| PubChem CID | 100788332 |
| Molecular Formula | C30H43ClN6S |
| Molecular Weight | 555.24 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[1-(4-chlorophenyl)cyclohexyl]methyl]thiourea |
| SMILES | C[C@@H]1CCCCN1c1cc(N2CCCCCC2)nc(NC(=S)NCC2(c3ccc(Cl)cc3)CCCCC2)n1 |
| InChI | InChI=1S/C30H43ClN6S/c1-23-11-5-10-20-37(23)27-21-26(36-18-8-2-3-9-19-36)33-28(34-27)35-29(38)32-22-30(16-6-4-7-17-30)24-12-14-25(31)15-13-24/h12-15,21,23H,2-11,16-20,22H2,1H3,(H2,32,33,34,35,38)/t23-/m1/s1 |
| InChIKey | VKFFTTNUJLBJDF-HSZRJFAPSA-N |
| XLogP | 7.08 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.24 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|