C25H31ClF3N5S — CID 100788466
1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100788466) has the molecular formula C25H31ClF3N5S and a molecular weight of 526.07 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100788466 |
| Molecular Formula | C25H31ClF3N5S |
| Molecular Weight | 526.07 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCCN1c1cc(C(F)(F)F)nc(NC(=S)NCC2(c3ccc(Cl)cc3)CCCCC2)n1 |
| InChI | InChI=1S/C25H31ClF3N5S/c1-17-7-3-6-14-34(17)21-15-20(25(27,28)29)31-22(32-21)33-23(35)30-16-24(12-4-2-5-13-24)18-8-10-19(26)11-9-18/h8-11,15,17H,2-7,12-14,16H2,1H3,(H2,30,31,32,33,35)/t17-/m1/s1 |
| InChIKey | ULDWDNIALIMMIP-QGZVFWFLSA-N |
| XLogP | 6.72 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.07 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|