C25H32F3N5S — CID 133178806
1-[4-(2-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea (PubChem CID 133178806) has the molecular formula C25H32F3N5S and a molecular weight of 491.63 g/mol. Its IUPAC name is 1-[4-(2-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea.
| Compound Name | 1-[4-(2-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea |
|---|---|
| PubChem CID | 133178806 |
| Molecular Formula | C25H32F3N5S |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 1-[4-(2-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea |
| SMILES | CC1CCCCN1c1cc(C(F)(F)F)nc(NC(=S)NCC2(c3ccccc3)CCCCC2)n1 |
| InChI | InChI=1S/C25H32F3N5S/c1-18-10-6-9-15-33(18)21-16-20(25(26,27)28)30-22(31-21)32-23(34)29-17-24(13-7-3-8-14-24)19-11-4-2-5-12-19/h2,4-5,11-12,16,18H,3,6-10,13-15,17H2,1H3,(H2,29,30,31,32,34) |
| InChIKey | VIDCGGULKBBYOU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|