C23H30ClN5S — CID 133179310
1-[4-chloro-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea (PubChem CID 133179310) has the molecular formula C23H30ClN5S and a molecular weight of 444.05 g/mol. Its IUPAC name is 1-[4-chloro-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea.
| Compound Name | 1-[4-chloro-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
|---|---|
| PubChem CID | 133179310 |
| Molecular Formula | C23H30ClN5S |
| Molecular Weight | 444.05 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 1-[4-chloro-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
| SMILES | CC1CCCCN1c1cc(Cl)nc(NC(=S)NCC2(c3ccccc3)CCCC2)n1 |
| InChI | InChI=1S/C23H30ClN5S/c1-17-9-5-8-14-29(17)20-15-19(24)26-21(27-20)28-22(30)25-16-23(12-6-7-13-23)18-10-3-2-4-11-18/h2-4,10-11,15,17H,5-9,12-14,16H2,1H3,(H2,25,26,27,28,30) |
| InChIKey | YUKXENROOPWLAM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.05 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|