C25H34ClN5S — CID 125047063
1-[[1-(3-chlorophenyl)cyclohexyl]methyl]-3-[4-methyl-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea (PubChem CID 125047063) has the molecular formula C25H34ClN5S and a molecular weight of 472.10 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)cyclohexyl]methyl]-3-[4-methyl-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea.
| Compound Name | 1-[[1-(3-chlorophenyl)cyclohexyl]methyl]-3-[4-methyl-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 125047063 |
| Molecular Formula | C25H34ClN5S |
| Molecular Weight | 472.10 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)cyclohexyl]methyl]-3-[4-methyl-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
| SMILES | Cc1cc(N2CCCC[C@H]2C)nc(NC(=S)NCC2(c3cccc(Cl)c3)CCCCC2)n1 |
| InChI | InChI=1S/C25H34ClN5S/c1-18-15-22(31-14-7-4-9-19(31)2)29-23(28-18)30-24(32)27-17-25(12-5-3-6-13-25)20-10-8-11-21(26)16-20/h8,10-11,15-16,19H,3-7,9,12-14,17H2,1-2H3,(H2,27,28,29,30,32)/t19-/m1/s1 |
| InChIKey | WUJXMXUXZWREFE-LJQANCHMSA-N |
| XLogP | 6.01 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.10 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|