C24H32ClN5OS — CID 100787411
1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-[4-methoxy-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea (PubChem CID 100787411) has the molecular formula C24H32ClN5OS and a molecular weight of 474.07 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-[4-methoxy-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea.
| Compound Name | 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-[4-methoxy-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100787411 |
| Molecular Formula | C24H32ClN5OS |
| Molecular Weight | 474.07 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-[4-methoxy-6-[(2S)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
| SMILES | COc1cc(N2CCCC[C@@H]2C)nc(NC(=S)NCC2(c3cccc(Cl)c3)CCCC2)n1 |
| InChI | InChI=1S/C24H32ClN5OS/c1-17-8-3-6-13-30(17)20-15-21(31-2)28-22(27-20)29-23(32)26-16-24(11-4-5-12-24)18-9-7-10-19(25)14-18/h7,9-10,14-15,17H,3-6,8,11-13,16H2,1-2H3,(H2,26,27,28,29,32)/t17-/m0/s1 |
| InChIKey | CLNUWTWBVDLDGC-KRWDZBQOSA-N |
| XLogP | 5.32 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.07 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|