C30H36FN5OS — CID 100789020
1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea (PubChem CID 100789020) has the molecular formula C30H36FN5OS and a molecular weight of 533.72 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea.
| Compound Name | 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100789020 |
| Molecular Formula | C30H36FN5OS |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCCN1c1cc(Oc2ccccc2)nc(NC(=S)NCC2(c3ccc(F)cc3)CCCCC2)n1 |
| InChI | InChI=1S/C30H36FN5OS/c1-22-10-6-9-19-36(22)26-20-27(37-25-11-4-2-5-12-25)34-28(33-26)35-29(38)32-21-30(17-7-3-8-18-30)23-13-15-24(31)16-14-23/h2,4-5,11-16,20,22H,3,6-10,17-19,21H2,1H3,(H2,32,33,34,35,38)/t22-/m1/s1 |
| InChIKey | MGXVHSGJGVSGFK-JOCHJYFZSA-N |
| XLogP | 6.98 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|