C25H27FN4O2S — CID 100788874
1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-(4-methoxy-6-phenoxypyrimidin-2-yl)thiourea (PubChem CID 100788874) has the molecular formula C25H27FN4O2S and a molecular weight of 466.58 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-(4-methoxy-6-phenoxypyrimidin-2-yl)thiourea.
| Compound Name | 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-(4-methoxy-6-phenoxypyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100788874 |
| Molecular Formula | C25H27FN4O2S |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-(4-methoxy-6-phenoxypyrimidin-2-yl)thiourea |
| SMILES | COc1cc(Oc2ccccc2)nc(NC(=S)NCC2(c3ccc(F)cc3)CCCCC2)n1 |
| InChI | InChI=1S/C25H27FN4O2S/c1-31-21-16-22(32-20-8-4-2-5-9-20)29-23(28-21)30-24(33)27-17-25(14-6-3-7-15-25)18-10-12-19(26)13-11-18/h2,4-5,8-13,16H,3,6-7,14-15,17H2,1H3,(H2,27,28,29,30,33) |
| InChIKey | MVMXXYHWISAZDV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|