C29H27ClN4O2S — CID 100787675
1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-(4,6-diphenoxypyrimidin-2-yl)thiourea (PubChem CID 100787675) has the molecular formula C29H27ClN4O2S and a molecular weight of 531.08 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-(4,6-diphenoxypyrimidin-2-yl)thiourea.
| Compound Name | 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-(4,6-diphenoxypyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100787675 |
| Molecular Formula | C29H27ClN4O2S |
| Molecular Weight | 531.08 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-(4,6-diphenoxypyrimidin-2-yl)thiourea |
| SMILES | S=C(NCC1(c2cccc(Cl)c2)CCCC1)Nc1nc(Oc2ccccc2)cc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C29H27ClN4O2S/c30-22-11-9-10-21(18-22)29(16-7-8-17-29)20-31-28(37)34-27-32-25(35-23-12-3-1-4-13-23)19-26(33-27)36-24-14-5-2-6-15-24/h1-6,9-15,18-19H,7-8,16-17,20H2,(H2,31,32,33,34,37) |
| InChIKey | KYFJZIHOWFVQSF-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.08 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|