C28H32ClN5O2S — CID 100788261
1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-(4-morpholin-4-yl-6-phenoxypyrimidin-2-yl)thiourea (PubChem CID 100788261) has the molecular formula C28H32ClN5O2S and a molecular weight of 538.12 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-(4-morpholin-4-yl-6-phenoxypyrimidin-2-yl)thiourea.
| Compound Name | 1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-(4-morpholin-4-yl-6-phenoxypyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100788261 |
| Molecular Formula | C28H32ClN5O2S |
| Molecular Weight | 538.12 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-(4-morpholin-4-yl-6-phenoxypyrimidin-2-yl)thiourea |
| SMILES | S=C(NCC1(c2ccc(Cl)cc2)CCCCC1)Nc1nc(Oc2ccccc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C28H32ClN5O2S/c29-22-11-9-21(10-12-22)28(13-5-2-6-14-28)20-30-27(37)33-26-31-24(34-15-17-35-18-16-34)19-25(32-26)36-23-7-3-1-4-8-23/h1,3-4,7-12,19H,2,5-6,13-18,20H2,(H2,30,31,32,33,37) |
| InChIKey | OLISQRHFIDKHID-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.12 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|