C24H26N4O2S — CID 100786234
1-(4-methoxy-6-phenoxypyrimidin-2-yl)-3-[(1-phenylcyclopentyl)methyl]thiourea (PubChem CID 100786234) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 1-(4-methoxy-6-phenoxypyrimidin-2-yl)-3-[(1-phenylcyclopentyl)methyl]thiourea.
| Compound Name | 1-(4-methoxy-6-phenoxypyrimidin-2-yl)-3-[(1-phenylcyclopentyl)methyl]thiourea |
|---|---|
| PubChem CID | 100786234 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-(4-methoxy-6-phenoxypyrimidin-2-yl)-3-[(1-phenylcyclopentyl)methyl]thiourea |
| SMILES | COc1cc(Oc2ccccc2)nc(NC(=S)NCC2(c3ccccc3)CCCC2)n1 |
| InChI | InChI=1S/C24H26N4O2S/c1-29-20-16-21(30-19-12-6-3-7-13-19)27-22(26-20)28-23(31)25-17-24(14-8-9-15-24)18-10-4-2-5-11-18/h2-7,10-13,16H,8-9,14-15,17H2,1H3,(H2,25,26,27,28,31) |
| InChIKey | KPCDJCGHCVIKKR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|