C18H21ClN4O2S — CID 100789448
1-(4-chloro-6-methoxypyrimidin-2-yl)-3-[(4-phenyloxan-4-yl)methyl]thiourea (PubChem CID 100789448) has the molecular formula C18H21ClN4O2S and a molecular weight of 392.91 g/mol. Its IUPAC name is 1-(4-chloro-6-methoxypyrimidin-2-yl)-3-[(4-phenyloxan-4-yl)methyl]thiourea.
| Compound Name | 1-(4-chloro-6-methoxypyrimidin-2-yl)-3-[(4-phenyloxan-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100789448 |
| Molecular Formula | C18H21ClN4O2S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-(4-chloro-6-methoxypyrimidin-2-yl)-3-[(4-phenyloxan-4-yl)methyl]thiourea |
| SMILES | COc1cc(Cl)nc(NC(=S)NCC2(c3ccccc3)CCOCC2)n1 |
| InChI | InChI=1S/C18H21ClN4O2S/c1-24-15-11-14(19)21-16(22-15)23-17(26)20-12-18(7-9-25-10-8-18)13-5-3-2-4-6-13/h2-6,11H,7-10,12H2,1H3,(H2,20,21,22,23,26) |
| InChIKey | SWAGWTVIAFWFMI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|