C24H31Cl2N5OS — CID 133178995
1-[4-chloro-6-(3,5-dimethylpiperidin-1-yl)pyrimidin-2-yl]-3-[[4-(4-chlorophenyl)oxan-4-yl]methyl]thiourea (PubChem CID 133178995) has the molecular formula C24H31Cl2N5OS and a molecular weight of 508.52 g/mol. Its IUPAC name is 1-[4-chloro-6-(3,5-dimethylpiperidin-1-yl)pyrimidin-2-yl]-3-[[4-(4-chlorophenyl)oxan-4-yl]methyl]thiourea.
| Compound Name | 1-[4-chloro-6-(3,5-dimethylpiperidin-1-yl)pyrimidin-2-yl]-3-[[4-(4-chlorophenyl)oxan-4-yl]methyl]thiourea |
|---|---|
| PubChem CID | 133178995 |
| Molecular Formula | C24H31Cl2N5OS |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 1-[4-chloro-6-(3,5-dimethylpiperidin-1-yl)pyrimidin-2-yl]-3-[[4-(4-chlorophenyl)oxan-4-yl]methyl]thiourea |
| SMILES | CC1CC(C)CN(c2cc(Cl)nc(NC(=S)NCC3(c4ccc(Cl)cc4)CCOCC3)n2)C1 |
| InChI | InChI=1S/C24H31Cl2N5OS/c1-16-11-17(2)14-31(13-16)21-12-20(26)28-22(29-21)30-23(33)27-15-24(7-9-32-10-8-24)18-3-5-19(25)6-4-18/h3-6,12,16-17H,7-11,13-15H2,1-2H3,(H2,27,28,29,30,33) |
| InChIKey | VPSYAJLRTHGAPQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|