C25H35N5OS — CID 100789422
1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea (PubChem CID 100789422) has the molecular formula C25H35N5OS and a molecular weight of 453.66 g/mol. Its IUPAC name is 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea.
| Compound Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100789422 |
| Molecular Formula | C25H35N5OS |
| Molecular Weight | 453.66 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
| SMILES | Cc1cc(N2C[C@H](C)C[C@@H](C)C2)nc(NC(=S)NCC2(c3ccccc3)CCOCC2)n1 |
| InChI | InChI=1S/C25H35N5OS/c1-18-13-19(2)16-30(15-18)22-14-20(3)27-23(28-22)29-24(32)26-17-25(9-11-31-12-10-25)21-7-5-4-6-8-21/h4-8,14,18-19H,9-13,15-17H2,1-3H3,(H2,26,27,28,29,32)/t18-,19-/m1/s1 |
| InChIKey | NVNFZJTVMNMPQM-RTBURBONSA-N |
| XLogP | 4.30 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.66 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|