C24H33N5S — CID 125046866
1-[4-methyl-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea (PubChem CID 125046866) has the molecular formula C24H33N5S and a molecular weight of 423.63 g/mol. Its IUPAC name is 1-[4-methyl-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea.
| Compound Name | 1-[4-methyl-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
|---|---|
| PubChem CID | 125046866 |
| Molecular Formula | C24H33N5S |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 1-[4-methyl-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
| SMILES | Cc1cc(N2CCC[C@H](C)C2)nc(NC(=S)NCC2(c3ccccc3)CCCC2)n1 |
| InChI | InChI=1S/C24H33N5S/c1-18-9-8-14-29(16-18)21-15-19(2)26-22(27-21)28-23(30)25-17-24(12-6-7-13-24)20-10-4-3-5-11-20/h3-5,10-11,15,18H,6-9,12-14,16-17H2,1-2H3,(H2,25,26,27,28,30)/t18-/m0/s1 |
| InChIKey | TYLILHJQDQVHNC-SFHVURJKSA-N |
| XLogP | 4.82 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|