C29H42N6S — CID 100786329
1-[4,6-bis(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea (PubChem CID 100786329) has the molecular formula C29H42N6S and a molecular weight of 506.76 g/mol. Its IUPAC name is 1-[4,6-bis(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea.
| Compound Name | 1-[4,6-bis(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
|---|---|
| PubChem CID | 100786329 |
| Molecular Formula | C29H42N6S |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | 1-[4,6-bis(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
| SMILES | CC1CCN(c2cc(N3CCC(C)CC3)nc(NC(=S)NCC3(c4ccccc4)CCCC3)n2)CC1 |
| InChI | InChI=1S/C29H42N6S/c1-22-10-16-34(17-11-22)25-20-26(35-18-12-23(2)13-19-35)32-27(31-25)33-28(36)30-21-29(14-6-7-15-29)24-8-4-3-5-9-24/h3-5,8-9,20,22-23H,6-7,10-19,21H2,1-2H3,(H2,30,31,32,33,36) |
| InChIKey | WVLYBMGHTUWJHJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|