C28H40N6S — CID 133179423
1-[4-(3-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea (PubChem CID 133179423) has the molecular formula C28H40N6S and a molecular weight of 492.74 g/mol. Its IUPAC name is 1-[4-(3-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea.
| Compound Name | 1-[4-(3-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea |
|---|---|
| PubChem CID | 133179423 |
| Molecular Formula | C28H40N6S |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | 1-[4-(3-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea |
| SMILES | CC1CCCN(c2cc(N3CCCC3)nc(NC(=S)NCC3(c4ccccc4)CCCCC3)n2)C1 |
| InChI | InChI=1S/C28H40N6S/c1-22-11-10-18-34(20-22)25-19-24(33-16-8-9-17-33)30-26(31-25)32-27(35)29-21-28(14-6-3-7-15-28)23-12-4-2-5-13-23/h2,4-5,12-13,19,22H,3,6-11,14-18,20-21H2,1H3,(H2,29,30,31,32,35) |
| InChIKey | GUFUFHIPFKUPCK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|