C27H37ClN6S — CID 100786565
1-[[1-(4-chlorophenyl)cyclopentyl]methyl]-3-[4-[(3S)-3-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100786565) has the molecular formula C27H37ClN6S and a molecular weight of 513.16 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)cyclopentyl]methyl]-3-[4-[(3S)-3-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[[1-(4-chlorophenyl)cyclopentyl]methyl]-3-[4-[(3S)-3-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100786565 |
| Molecular Formula | C27H37ClN6S |
| Molecular Weight | 513.16 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)cyclopentyl]methyl]-3-[4-[(3S)-3-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | C[C@H]1CCCN(c2cc(N3CCCC3)nc(NC(=S)NCC3(c4ccc(Cl)cc4)CCCC3)n2)C1 |
| InChI | InChI=1S/C27H37ClN6S/c1-20-7-6-16-34(18-20)24-17-23(33-14-4-5-15-33)30-25(31-24)32-26(35)29-19-27(12-2-3-13-27)21-8-10-22(28)11-9-21/h8-11,17,20H,2-7,12-16,18-19H2,1H3,(H2,29,30,31,32,35)/t20-/m0/s1 |
| InChIKey | FOJQZUQTWOKSBX-FQEVSTJZSA-N |
| XLogP | 5.76 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.16 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|