C37H44N8S — CID 100786398
1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea (PubChem CID 100786398) has the molecular formula C37H44N8S and a molecular weight of 632.88 g/mol. Its IUPAC name is 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea.
| Compound Name | 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
|---|---|
| PubChem CID | 100786398 |
| Molecular Formula | C37H44N8S |
| Molecular Weight | 632.88 g/mol |
| Exact Mass | 632.34 |
| IUPAC Name | 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
| SMILES | S=C(NCC1(c2ccccc2)CCCC1)Nc1nc(N2CCN(c3ccccc3)CC2)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C37H44N8S/c46-36(38-29-37(18-10-11-19-37)30-12-4-1-5-13-30)41-35-39-33(44-24-20-42(21-25-44)31-14-6-2-7-15-31)28-34(40-35)45-26-22-43(23-27-45)32-16-8-3-9-17-32/h1-9,12-17,28H,10-11,18-27,29H2,(H2,38,39,40,41,46) |
| InChIKey | QSYTZBFMIKLERB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.88 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|