C33H42FN7S — CID 100788924
1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100788924) has the molecular formula C33H42FN7S and a molecular weight of 587.81 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100788924 |
| Molecular Formula | C33H42FN7S |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.32 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | Fc1ccc(C2(CNC(=S)Nc3nc(N4CCCCC4)cc(N4CCN(c5ccccc5)CC4)n3)CCCCC2)cc1 |
| InChI | InChI=1S/C33H42FN7S/c34-27-14-12-26(13-15-27)33(16-6-2-7-17-33)25-35-32(42)38-31-36-29(40-18-8-3-9-19-40)24-30(37-31)41-22-20-39(21-23-41)28-10-4-1-5-11-28/h1,4-5,10-15,24H,2-3,6-9,16-23,25H2,(H2,35,36,37,38,42) |
| InChIKey | VFJQAHVVCPSCMP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|