C26H35FN6O2S — CID 100788935
1-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea (PubChem CID 100788935) has the molecular formula C26H35FN6O2S and a molecular weight of 514.67 g/mol. Its IUPAC name is 1-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea.
| Compound Name | 1-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea |
|---|---|
| PubChem CID | 100788935 |
| Molecular Formula | C26H35FN6O2S |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 1-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea |
| SMILES | Fc1ccc(C2(CNC(=S)Nc3nc(N4CCOCC4)cc(N4CCOCC4)n3)CCCCC2)cc1 |
| InChI | InChI=1S/C26H35FN6O2S/c27-21-6-4-20(5-7-21)26(8-2-1-3-9-26)19-28-25(36)31-24-29-22(32-10-14-34-15-11-32)18-23(30-24)33-12-16-35-17-13-33/h4-7,18H,1-3,8-17,19H2,(H2,28,29,30,31,36) |
| InChIKey | CEHJCRPZQQXFRX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|