C31H45FN6S — CID 100789037
1-[4-(azepan-1-yl)-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea (PubChem CID 100789037) has the molecular formula C31H45FN6S and a molecular weight of 552.81 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea |
|---|---|
| PubChem CID | 100789037 |
| Molecular Formula | C31H45FN6S |
| Molecular Weight | 552.81 g/mol |
| Exact Mass | 552.34 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea |
| SMILES | C[C@H]1C[C@H](C)CN(c2cc(N3CCCCCC3)nc(NC(=S)NCC3(c4ccc(F)cc4)CCCCC3)n2)C1 |
| InChI | InChI=1S/C31H45FN6S/c1-23-18-24(2)21-38(20-23)28-19-27(37-16-8-3-4-9-17-37)34-29(35-28)36-30(39)33-22-31(14-6-5-7-15-31)25-10-12-26(32)13-11-25/h10-13,19,23-24H,3-9,14-18,20-22H2,1-2H3,(H2,33,34,35,36,39)/t23-,24-/m0/s1 |
| InChIKey | VKFYONICDZHMSR-ZEQRLZLVSA-N |
| XLogP | 6.67 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.81 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|