C35H47N7S — CID 133178802
1-[4-(3,5-dimethylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea (PubChem CID 133178802) has the molecular formula C35H47N7S and a molecular weight of 597.88 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea |
|---|---|
| PubChem CID | 133178802 |
| Molecular Formula | C35H47N7S |
| Molecular Weight | 597.88 g/mol |
| Exact Mass | 597.36 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea |
| SMILES | CC1CC(C)CN(c2cc(N3CCN(c4ccccc4)CC3)nc(NC(=S)NCC3(c4ccccc4)CCCCC3)n2)C1 |
| InChI | InChI=1S/C35H47N7S/c1-27-22-28(2)25-42(24-27)32-23-31(41-20-18-40(19-21-41)30-14-8-4-9-15-30)37-33(38-32)39-34(43)36-26-35(16-10-5-11-17-35)29-12-6-3-7-13-29/h3-4,6-9,12-15,23,27-28H,5,10-11,16-22,24-26H2,1-2H3,(H2,36,37,38,39,43) |
| InChIKey | WTNDINOECRZPLM-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.88 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|