C28H40N6O2S — CID 100789295
1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea (PubChem CID 100789295) has the molecular formula C28H40N6O2S and a molecular weight of 524.74 g/mol. Its IUPAC name is 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea.
| Compound Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100789295 |
| Molecular Formula | C28H40N6O2S |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2cc(N3CCOCC3)nc(NC(=S)NCC3(c4ccccc4)CCOCC3)n2)C1 |
| InChI | InChI=1S/C28H40N6O2S/c1-21-16-22(2)19-34(18-21)25-17-24(33-10-14-36-15-11-33)30-26(31-25)32-27(37)29-20-28(8-12-35-13-9-28)23-6-4-3-5-7-23/h3-7,17,21-22H,8-16,18-20H2,1-2H3,(H2,29,30,31,32,37)/t21-,22-/m1/s1 |
| InChIKey | HVASTGHTABTUFE-FGZHOGPDSA-N |
| XLogP | 3.83 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|