C28H39ClN6OS — CID 100787528
1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea (PubChem CID 100787528) has the molecular formula C28H39ClN6OS and a molecular weight of 543.18 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100787528 |
| Molecular Formula | C28H39ClN6OS |
| Molecular Weight | 543.18 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
| SMILES | C[C@H]1C[C@H](C)CN(c2cc(N3CCOCC3)nc(NC(=S)NCC3(c4cccc(Cl)c4)CCCC3)n2)C1 |
| InChI | InChI=1S/C28H39ClN6OS/c1-20-14-21(2)18-35(17-20)25-16-24(34-10-12-36-13-11-34)31-26(32-25)33-27(37)30-19-28(8-3-4-9-28)22-6-5-7-23(29)15-22/h5-7,15-16,20-21H,3-4,8-14,17-19H2,1-2H3,(H2,30,31,32,33,37)/t20-,21-/m0/s1 |
| InChIKey | IFXJWZDDQFWJGP-SFTDATJTSA-N |
| XLogP | 5.25 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.18 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|