C31H39N7S — CID 100786268
1-[(1-phenylcyclopentyl)methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100786268) has the molecular formula C31H39N7S and a molecular weight of 541.77 g/mol. Its IUPAC name is 1-[(1-phenylcyclopentyl)methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[(1-phenylcyclopentyl)methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100786268 |
| Molecular Formula | C31H39N7S |
| Molecular Weight | 541.77 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | 1-[(1-phenylcyclopentyl)methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | S=C(NCC1(c2ccccc2)CCCC1)Nc1nc(N2CCCC2)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C31H39N7S/c39-30(32-24-31(15-7-8-16-31)25-11-3-1-4-12-25)35-29-33-27(37-17-9-10-18-37)23-28(34-29)38-21-19-36(20-22-38)26-13-5-2-6-14-26/h1-6,11-14,23H,7-10,15-22,24H2,(H2,32,33,34,35,39) |
| InChIKey | BQHWHPCZZRSOQY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.77 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|