C24H33N5OS — CID 100789419
1-[4-methyl-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea (PubChem CID 100789419) has the molecular formula C24H33N5OS and a molecular weight of 439.63 g/mol. Its IUPAC name is 1-[4-methyl-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea.
| Compound Name | 1-[4-methyl-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100789419 |
| Molecular Formula | C24H33N5OS |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 1-[4-methyl-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
| SMILES | Cc1cc(N2CCC[C@@H](C)C2)nc(NC(=S)NCC2(c3ccccc3)CCOCC2)n1 |
| InChI | InChI=1S/C24H33N5OS/c1-18-7-6-12-29(16-18)21-15-19(2)26-22(27-21)28-23(31)25-17-24(10-13-30-14-11-24)20-8-4-3-5-9-20/h3-5,8-9,15,18H,6-7,10-14,16-17H2,1-2H3,(H2,25,26,27,28,31)/t18-/m1/s1 |
| InChIKey | FBXPHYUHSMJEJF-GOSISDBHSA-N |
| XLogP | 4.06 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|