C25H33ClN4OS — CID 133149931
1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[6-(3,5-dimethylpiperidin-1-yl)-3-pyridinyl]thiourea (PubChem CID 133149931) has the molecular formula C25H33ClN4OS and a molecular weight of 473.09 g/mol. Its IUPAC name is 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[6-(3,5-dimethylpiperidin-1-yl)-3-pyridinyl]thiourea.
| Compound Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[6-(3,5-dimethylpiperidin-1-yl)-3-pyridinyl]thiourea |
|---|---|
| PubChem CID | 133149931 |
| Molecular Formula | C25H33ClN4OS |
| Molecular Weight | 473.09 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[6-(3,5-dimethylpiperidin-1-yl)-3-pyridinyl]thiourea |
| SMILES | CC1CC(C)CN(c2ccc(NC(=S)NCC3(c4ccc(Cl)cc4)CCOCC3)cn2)C1 |
| InChI | InChI=1S/C25H33ClN4OS/c1-18-13-19(2)16-30(15-18)23-8-7-22(14-27-23)29-24(32)28-17-25(9-11-31-12-10-25)20-3-5-21(26)6-4-20/h3-8,14,18-19H,9-13,15-17H2,1-2H3,(H2,28,29,32) |
| InChIKey | HXEVLNFGGBXYQK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.09 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|