C20H25ClN4S — CID 133149846
1-[(2-chlorophenyl)methyl]-3-[6-(3,5-dimethylpiperidin-1-yl)-3-pyridinyl]thiourea (PubChem CID 133149846) has the molecular formula C20H25ClN4S and a molecular weight of 388.97 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-[6-(3,5-dimethylpiperidin-1-yl)-3-pyridinyl]thiourea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-[6-(3,5-dimethylpiperidin-1-yl)-3-pyridinyl]thiourea |
|---|---|
| PubChem CID | 133149846 |
| Molecular Formula | C20H25ClN4S |
| Molecular Weight | 388.97 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-[6-(3,5-dimethylpiperidin-1-yl)-3-pyridinyl]thiourea |
| SMILES | CC1CC(C)CN(c2ccc(NC(=S)NCc3ccccc3Cl)cn2)C1 |
| InChI | InChI=1S/C20H25ClN4S/c1-14-9-15(2)13-25(12-14)19-8-7-17(11-22-19)24-20(26)23-10-16-5-3-4-6-18(16)21/h3-8,11,14-15H,9-10,12-13H2,1-2H3,(H2,23,24,26) |
| InChIKey | ZNYHUPREBWVNCV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.97 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|