C22H29ClN6OS — CID 133197173
1-[(2-chlorophenyl)methyl]-3-[4-(3-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea (PubChem CID 133197173) has the molecular formula C22H29ClN6OS and a molecular weight of 461.04 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-[4-(3-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-[4-(3-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133197173 |
| Molecular Formula | C22H29ClN6OS |
| Molecular Weight | 461.04 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-[4-(3-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
| SMILES | CC1CCCN(c2cc(N3CCOCC3)nc(NC(=S)NCc3ccccc3Cl)n2)C1 |
| InChI | InChI=1S/C22H29ClN6OS/c1-16-5-4-8-29(15-16)20-13-19(28-9-11-30-12-10-28)25-21(26-20)27-22(31)24-14-17-6-2-3-7-18(17)23/h2-3,6-7,13,16H,4-5,8-12,14-15H2,1H3,(H2,24,25,26,27,31) |
| InChIKey | AFXJVNHOSZLANF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.04 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|