C21H29N7OS — CID 133197210
1-[4-(3-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 133197210) has the molecular formula C21H29N7OS and a molecular weight of 427.58 g/mol. Its IUPAC name is 1-[4-(3-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[4-(3-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 133197210 |
| Molecular Formula | C21H29N7OS |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 1-[4-(3-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | CC1CCCN(c2cc(N3CCOCC3)nc(NC(=S)NCc3cccnc3)n2)C1 |
| InChI | InChI=1S/C21H29N7OS/c1-16-4-3-7-28(15-16)19-12-18(27-8-10-29-11-9-27)24-20(25-19)26-21(30)23-14-17-5-2-6-22-13-17/h2,5-6,12-13,16H,3-4,7-11,14-15H2,1H3,(H2,23,24,25,26,30) |
| InChIKey | ONDAQFMXLVKVKK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|