C23H33N7S — CID 100782343
1-[4-(azepan-1-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 100782343) has the molecular formula C23H33N7S and a molecular weight of 439.63 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100782343 |
| Molecular Formula | C23H33N7S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | CC1CCN(c2cc(N3CCCCCC3)nc(NC(=S)NCc3cccnc3)n2)CC1 |
| InChI | InChI=1S/C23H33N7S/c1-18-8-13-30(14-9-18)21-15-20(29-11-4-2-3-5-12-29)26-22(27-21)28-23(31)25-17-19-7-6-10-24-16-19/h6-7,10,15-16,18H,2-5,8-9,11-14,17H2,1H3,(H2,25,26,27,28,31) |
| InChIKey | CWECQPJEAOKAQR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|