C17H28N6S — CID 100773876
1-ethyl-3-[4-(4-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100773876) has the molecular formula C17H28N6S and a molecular weight of 348.52 g/mol. Its IUPAC name is 1-ethyl-3-[4-(4-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-ethyl-3-[4-(4-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100773876 |
| Molecular Formula | C17H28N6S |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-ethyl-3-[4-(4-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | CCNC(=S)Nc1nc(N2CCCC2)cc(N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C17H28N6S/c1-3-18-17(24)21-16-19-14(22-8-4-5-9-22)12-15(20-16)23-10-6-13(2)7-11-23/h12-13H,3-11H2,1-2H3,(H2,18,19,20,21,24) |
| InChIKey | XRKGMGZQUXUVTF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|