C15H24N6O2S — CID 100774008
1-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-3-ethylthiourea (PubChem CID 100774008) has the molecular formula C15H24N6O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-3-ethylthiourea.
| Compound Name | 1-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-3-ethylthiourea |
|---|---|
| PubChem CID | 100774008 |
| Molecular Formula | C15H24N6O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1nc(N2CCOCC2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H24N6O2S/c1-2-16-15(24)19-14-17-12(20-3-7-22-8-4-20)11-13(18-14)21-5-9-23-10-6-21/h11H,2-10H2,1H3,(H2,16,17,18,19,24) |
| InChIKey | CDSQZPFRRCQYEM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|