C13H19N5O2S — CID 100780232
1-(4-methoxy-6-morpholin-4-ylpyrimidin-2-yl)-3-prop-2-enylthiourea (PubChem CID 100780232) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 1-(4-methoxy-6-morpholin-4-ylpyrimidin-2-yl)-3-prop-2-enylthiourea.
| Compound Name | 1-(4-methoxy-6-morpholin-4-ylpyrimidin-2-yl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 100780232 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-(4-methoxy-6-morpholin-4-ylpyrimidin-2-yl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1nc(OC)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H19N5O2S/c1-3-4-14-13(21)17-12-15-10(9-11(16-12)19-2)18-5-7-20-8-6-18/h3,9H,1,4-8H2,2H3,(H2,14,15,16,17,21) |
| InChIKey | YHPUUZVSMQACHX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|