C15H23N5S — CID 100780539
1-[4-(azepan-1-yl)-6-methylpyrimidin-2-yl]-3-prop-2-enylthiourea (PubChem CID 100780539) has the molecular formula C15H23N5S and a molecular weight of 305.45 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-methylpyrimidin-2-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-methylpyrimidin-2-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 100780539 |
| Molecular Formula | C15H23N5S |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-methylpyrimidin-2-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1nc(C)cc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C15H23N5S/c1-3-8-16-15(21)19-14-17-12(2)11-13(18-14)20-9-6-4-5-7-10-20/h3,11H,1,4-10H2,2H3,(H2,16,17,18,19,21) |
| InChIKey | DKWQFTMGJNMBLD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|