C10H14N4S — CID 4997236
1-(4,6-dimethylpyrimidin-2-yl)-3-prop-2-enylthiourea (PubChem CID 4997236) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-3-prop-2-enylthiourea.
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 4997236 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C10H14N4S/c1-4-5-11-10(15)14-9-12-7(2)6-8(3)13-9/h4,6H,1,5H2,2-3H3,(H2,11,12,13,14,15) |
| InChIKey | KBVSAPQWSWIMIH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|