C10H11F3N4OS — CID 100780548
1-[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]-3-prop-2-enylthiourea (PubChem CID 100780548) has the molecular formula C10H11F3N4OS and a molecular weight of 292.29 g/mol. Its IUPAC name is 1-[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 100780548 |
| Molecular Formula | C10H11F3N4OS |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1nc(OC)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H11F3N4OS/c1-3-4-14-9(19)17-8-15-6(10(11,12)13)5-7(16-8)18-2/h3,5H,1,4H2,2H3,(H2,14,15,16,17,19) |
| InChIKey | XFAQRKJJWYJDKJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|