C10H13F3N4O2S — CID 100777019
1-(2-methoxyethyl)-3-[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100777019) has the molecular formula C10H13F3N4O2S and a molecular weight of 310.30 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100777019 |
| Molecular Formula | C10H13F3N4O2S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | COCCNC(=S)Nc1nc(OC)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N4O2S/c1-18-4-3-14-9(20)17-8-15-6(10(11,12)13)5-7(16-8)19-2/h5H,3-4H2,1-2H3,(H2,14,15,16,17,20) |
| InChIKey | UCPKNJHMNMKVHU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|