C14H15ClN4O2S — CID 100781397
1-[(4-chlorophenyl)methyl]-3-(4,6-dimethoxypyrimidin-2-yl)thiourea (PubChem CID 100781397) has the molecular formula C14H15ClN4O2S and a molecular weight of 338.82 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(4,6-dimethoxypyrimidin-2-yl)thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(4,6-dimethoxypyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100781397 |
| Molecular Formula | C14H15ClN4O2S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(4,6-dimethoxypyrimidin-2-yl)thiourea |
| SMILES | COc1cc(OC)nc(NC(=S)NCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H15ClN4O2S/c1-20-11-7-12(21-2)18-13(17-11)19-14(22)16-8-9-3-5-10(15)6-4-9/h3-7H,8H2,1-2H3,(H2,16,17,18,19,22) |
| InChIKey | XZYGKECURUECAF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|