C19H23ClN4O3S — CID 100789468
1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-(4,6-dimethoxypyrimidin-2-yl)thiourea (PubChem CID 100789468) has the molecular formula C19H23ClN4O3S and a molecular weight of 422.94 g/mol. Its IUPAC name is 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-(4,6-dimethoxypyrimidin-2-yl)thiourea.
| Compound Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-(4,6-dimethoxypyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100789468 |
| Molecular Formula | C19H23ClN4O3S |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-(4,6-dimethoxypyrimidin-2-yl)thiourea |
| SMILES | COc1cc(OC)nc(NC(=S)NCC2(c3ccc(Cl)cc3)CCOCC2)n1 |
| InChI | InChI=1S/C19H23ClN4O3S/c1-25-15-11-16(26-2)23-17(22-15)24-18(28)21-12-19(7-9-27-10-8-19)13-3-5-14(20)6-4-13/h3-6,11H,7-10,12H2,1-2H3,(H2,21,22,23,24,28) |
| InChIKey | HIILXVBZHXIWMB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|