C23H25ClN6OS2 — CID 100788149
1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-(4-methoxy-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea (PubChem CID 100788149) has the molecular formula C23H25ClN6OS2 and a molecular weight of 501.08 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-(4-methoxy-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-(4-methoxy-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100788149 |
| Molecular Formula | C23H25ClN6OS2 |
| Molecular Weight | 501.08 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-(4-methoxy-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea |
| SMILES | COc1cc(Sc2ncccn2)nc(NC(=S)NCC2(c3ccc(Cl)cc3)CCCCC2)n1 |
| InChI | InChI=1S/C23H25ClN6OS2/c1-31-18-14-19(33-22-25-12-5-13-26-22)29-20(28-18)30-21(32)27-15-23(10-3-2-4-11-23)16-6-8-17(24)9-7-16/h5-9,12-14H,2-4,10-11,15H2,1H3,(H2,27,28,29,30,32) |
| InChIKey | PWLRHSNCAZBWQM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.08 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|