C23H25FN6S2 — CID 100789103
1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-(4-methyl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea (PubChem CID 100789103) has the molecular formula C23H25FN6S2 and a molecular weight of 468.63 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-(4-methyl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-(4-methyl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100789103 |
| Molecular Formula | C23H25FN6S2 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-(4-methyl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea |
| SMILES | Cc1cc(Sc2ncccn2)nc(NC(=S)NCC2(c3ccc(F)cc3)CCCCC2)n1 |
| InChI | InChI=1S/C23H25FN6S2/c1-16-14-19(32-22-25-12-5-13-26-22)29-20(28-16)30-21(31)27-15-23(10-3-2-4-11-23)17-6-8-18(24)9-7-17/h5-9,12-14H,2-4,10-11,15H2,1H3,(H2,27,28,29,30,31) |
| InChIKey | GLNGDLMOVOPSPX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|